C11H14BrNO — CID 131146254
(1R)-6-bromo-8-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 131146254) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is (1R)-6-bromo-8-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-6-bromo-8-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 131146254 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | (1R)-6-bromo-8-methoxy-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | COc1cc(Br)cc2c1[C@H](N)CCC2 |
| InChI | InChI=1S/C11H14BrNO/c1-14-10-6-8(12)5-7-3-2-4-9(13)11(7)10/h5-6,9H,2-4,13H2,1H3/t9-/m1/s1 |
| InChIKey | WYTUCSCWCRTGAZ-SECBINFHSA-N |
| XLogP | 2.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |