About N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide
N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide (PubChem CID 131089125) has the molecular formula C9H12N2OS
and a molecular weight of 196.27 g/mol. Its IUPAC name is N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide |
| PubChem CID | 131089125 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C2CC2)ns1 |
| InChI | InChI=1S/C9H12N2OS/c1-6-5-8(10-13-6)9(12)11(2)7-3-4-7/h5,7H,3-4H2,1-2H3 |
| InChIKey | WDJAWIRZYDBUNL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide?
The IUPAC name of N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide (CID 131089125) is N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide.
What is the SMILES notation for N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide?
The canonical SMILES for N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide is Cc1cc(C(=O)N(C)C2CC2)ns1.
What is the InChIKey of N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide?
The InChIKey is WDJAWIRZYDBUNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS/c1-6-5-8(10-13-6)9(12)11(2)7-3-4-7/h5,7H,3-4H2,1-2H3.
What are the key properties of N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide?
N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide has a molecular weight of 196.27 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 131089125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).