C9H12N2OS — CID 131089125
N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide (PubChem CID 131089125) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide.
| Compound Name | N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 131089125 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | N-cyclopropyl-N,5-dimethyl-1,2-thiazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C2CC2)ns1 |
| InChI | InChI=1S/C9H12N2OS/c1-6-5-8(10-13-6)9(12)11(2)7-3-4-7/h5,7H,3-4H2,1-2H3 |
| InChIKey | WDJAWIRZYDBUNL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |