About N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide
N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide (PubChem CID 130684550) has the molecular formula C9H12N2OS
and a molecular weight of 196.27 g/mol. Its IUPAC name is N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide.
Analyze N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide?
The IUPAC name of N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide (CID 130684550) is N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide.
What is the SMILES notation for N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide?
The canonical SMILES for N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide is Cc1nscc1C(=O)N(C)C1CC1.
What is the InChIKey of N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide?
The InChIKey is MMRHQTYWQIHUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS/c1-6-8(5-13-10-6)9(12)11(2)7-3-4-7/h5,7H,3-4H2,1-2H3.
What are the key properties of N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide?
N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide has a molecular weight of 196.27 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N,3-dimethyl-1,2-thiazole-4-carboxamide is sourced from PubChem (CID 130684550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).