About 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride
3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride (PubChem CID 131089409) has the molecular formula C8H16ClNO4S
and a molecular weight of 257.74 g/mol. Its IUPAC name is 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride |
| PubChem CID | 131089409 |
| Molecular Formula | C8H16ClNO4S |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride |
| SMILES | CC1CN(CCC(=O)O)CCS1(=O)=O.Cl |
| InChI | InChI=1S/C8H15NO4S.ClH/c1-7-6-9(3-2-8(10)11)4-5-14(7,12)13;/h7H,2-6H2,1H3,(H,10,11);1H |
| InChIKey | WFMRNPSRPBJWKQ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride?
The IUPAC name of 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride (CID 131089409) is 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride.
What is the SMILES notation for 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride?
The canonical SMILES for 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride is CC1CN(CCC(=O)O)CCS1(=O)=O.Cl.
What is the InChIKey of 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride?
The InChIKey is WFMRNPSRPBJWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4S.ClH/c1-7-6-9(3-2-8(10)11)4-5-14(7,12)13;/h7H,2-6H2,1H3,(H,10,11);1H.
What are the key properties of 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride?
3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride has a molecular weight of 257.74 g/mol, XLogP of 0.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid;hydrochloride is sourced from PubChem (CID 131089409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).