3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid

C9H15F2NO2 — CID 130669966

IUPAC3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid
SMILESCC1CN(CCC(=O)O)CCC1(F)F
InChIInChI=1S/C9H15F2NO2/c1-7-6-12(4-2-8(13)14)5-3-9(7,10)11/h7H,2-6H2,1H3,(H,13,14)
InChIKeyPAKDXBYXPJRTBK-UHFFFAOYSA-N
MW207.22 g/mol
LogP1.44
Rot. Bonds3

About 3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid

3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid (PubChem CID 130669966) has the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. Its IUPAC name is 3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid.

Molecular Properties

Compound Name3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid
PubChem CID130669966
Molecular FormulaC9H15F2NO2
Molecular Weight207.22 g/mol
Exact Mass207.11
IUPAC Name3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid
SMILESCC1CN(CCC(=O)O)CCC1(F)F
InChIInChI=1S/C9H15F2NO2/c1-7-6-12(4-2-8(13)14)5-3-9(7,10)11/h7H,2-6H2,1H3,(H,13,14)
InChIKeyPAKDXBYXPJRTBK-UHFFFAOYSA-N
XLogP1.44
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.22
LogP ≤ 51.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid?
The IUPAC name of 3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid (CID 130669966) is 3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid.
What is the SMILES notation for 3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid?
The canonical SMILES for 3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid is CC1CN(CCC(=O)O)CCC1(F)F.
What is the InChIKey of 3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid?
The InChIKey is PAKDXBYXPJRTBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO2/c1-7-6-12(4-2-8(13)14)5-3-9(7,10)11/h7H,2-6H2,1H3,(H,13,14).
What are the key properties of 3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid?
3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid has a molecular weight of 207.22 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-difluoro-3-methylpiperidin-1-yl)propanoic acid is sourced from PubChem (CID 130669966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).