C11H17F2NO — CID 125143336
1-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]pent-4-en-1-one (PubChem CID 125143336) has the molecular formula C11H17F2NO and a molecular weight of 217.26 g/mol. Its IUPAC name is 1-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]pent-4-en-1-one.
| Compound Name | 1-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 125143336 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCC(F)(F)[C@H](C)C1 |
| InChI | InChI=1S/C11H17F2NO/c1-3-4-5-10(15)14-7-6-11(12,13)9(2)8-14/h3,9H,1,4-8H2,2H3/t9-/m1/s1 |
| InChIKey | QFTDYDLLPMWFFX-SECBINFHSA-N |
| XLogP | 2.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|