About 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile
6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile (PubChem CID 131092138) has the molecular formula C6H2ClN5
and a molecular weight of 179.57 g/mol. Its IUPAC name is 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile.
Analyze 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile?
The IUPAC name of 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile (CID 131092138) is 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile.
What is the SMILES notation for 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile?
The canonical SMILES for 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile is N#Cc1nnc2cnc(Cl)cn12.
What is the InChIKey of 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile?
The InChIKey is IUQOPEGLPQTULV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2ClN5/c7-4-3-12-5(1-8)10-11-6(12)2-9-4/h2-3H.
What are the key properties of 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile?
6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile has a molecular weight of 179.57 g/mol, XLogP of 0.65, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carbonitrile is sourced from PubChem (CID 131092138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).