C11H18N2O — CID 131092196
1-(3-methylidene-4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)ethanone (PubChem CID 131092196) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(3-methylidene-4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)ethanone.
| Compound Name | 1-(3-methylidene-4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 131092196 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-(3-methylidene-4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)ethanone |
| SMILES | C=C1CN2CCCCC2CN1C(C)=O |
| InChI | InChI=1S/C11H18N2O/c1-9-7-12-6-4-3-5-11(12)8-13(9)10(2)14/h11H,1,3-8H2,2H3 |
| InChIKey | XHBWEMPXAUOPEQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |