C8H13FN2O — CID 142444575
2-fluoro-4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-3-one (PubChem CID 142444575) has the molecular formula C8H13FN2O and a molecular weight of 172.20 g/mol. Its IUPAC name is 2-fluoro-4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-3-one.
| Compound Name | 2-fluoro-4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-3-one |
|---|---|
| PubChem CID | 142444575 |
| Molecular Formula | C8H13FN2O |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-fluoro-4,6,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-3-one |
| SMILES | O=C1CN2CCCCC2CN1F |
| InChI | InChI=1S/C8H13FN2O/c9-11-5-7-3-1-2-4-10(7)6-8(11)12/h7H,1-6H2 |
| InChIKey | PLRZWRJGSNVQHU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|