C9H15N3O — CID 131097140
2-N-ethoxy-2-N,4-dimethylpyridine-2,5-diamine (PubChem CID 131097140) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-N-ethoxy-2-N,4-dimethylpyridine-2,5-diamine.
| Compound Name | 2-N-ethoxy-2-N,4-dimethylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 131097140 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-N-ethoxy-2-N,4-dimethylpyridine-2,5-diamine |
| SMILES | CCON(C)c1cc(C)c(N)cn1 |
| InChI | InChI=1S/C9H15N3O/c1-4-13-12(3)9-5-7(2)8(10)6-11-9/h5-6H,4,10H2,1-3H3 |
| InChIKey | DQXABVLNRVVRSX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|