C9H15N3O — CID 130653918
N-ethoxy-N,5,6-trimethylpyridazin-3-amine (PubChem CID 130653918) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is N-ethoxy-N,5,6-trimethylpyridazin-3-amine.
| Compound Name | N-ethoxy-N,5,6-trimethylpyridazin-3-amine |
|---|---|
| PubChem CID | 130653918 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | N-ethoxy-N,5,6-trimethylpyridazin-3-amine |
| SMILES | CCON(C)c1cc(C)c(C)nn1 |
| InChI | InChI=1S/C9H15N3O/c1-5-13-12(4)9-6-7(2)8(3)10-11-9/h6H,5H2,1-4H3 |
| InChIKey | YTSZKOCJONQORA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|