C10H10S2 — CID 131098252
3,5-dimethyl-1-benzothiophene-7-thiol (PubChem CID 131098252) has the molecular formula C10H10S2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 3,5-dimethyl-1-benzothiophene-7-thiol.
| Compound Name | 3,5-dimethyl-1-benzothiophene-7-thiol |
|---|---|
| PubChem CID | 131098252 |
| Molecular Formula | C10H10S2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 3,5-dimethyl-1-benzothiophene-7-thiol |
| SMILES | Cc1cc(S)c2scc(C)c2c1 |
| InChI | InChI=1S/C10H10S2/c1-6-3-8-7(2)5-12-10(8)9(11)4-6/h3-5,11H,1-2H3 |
| InChIKey | IIDWJJAUPYYTPD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|