C10H9IS — CID 131053740
3-iodo-5,7-dimethyl-1-benzothiophene (PubChem CID 131053740) has the molecular formula C10H9IS and a molecular weight of 288.15 g/mol. Its IUPAC name is 3-iodo-5,7-dimethyl-1-benzothiophene.
| Compound Name | 3-iodo-5,7-dimethyl-1-benzothiophene |
|---|---|
| PubChem CID | 131053740 |
| Molecular Formula | C10H9IS |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 3-iodo-5,7-dimethyl-1-benzothiophene |
| SMILES | Cc1cc(C)c2scc(I)c2c1 |
| InChI | InChI=1S/C10H9IS/c1-6-3-7(2)10-8(4-6)9(11)5-12-10/h3-5H,1-2H3 |
| InChIKey | WIZKVYLNLFCDJR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|