About 3-iodo-5,7-dimethyl-1-benzothiophene
3-iodo-5,7-dimethyl-1-benzothiophene (PubChem CID 131053740) has the molecular formula C10H9IS
and a molecular weight of 288.15 g/mol. Its IUPAC name is 3-iodo-5,7-dimethyl-1-benzothiophene.
Molecular Properties
| Compound Name | 3-iodo-5,7-dimethyl-1-benzothiophene |
| PubChem CID | 131053740 |
| Molecular Formula | C10H9IS |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 3-iodo-5,7-dimethyl-1-benzothiophene |
| SMILES | Cc1cc(C)c2scc(I)c2c1 |
| InChI | InChI=1S/C10H9IS/c1-6-3-7(2)10-8(4-6)9(11)5-12-10/h3-5H,1-2H3 |
| InChIKey | WIZKVYLNLFCDJR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-5,7-dimethyl-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-5,7-dimethyl-1-benzothiophene?
The IUPAC name of 3-iodo-5,7-dimethyl-1-benzothiophene (CID 131053740) is 3-iodo-5,7-dimethyl-1-benzothiophene.
What is the SMILES notation for 3-iodo-5,7-dimethyl-1-benzothiophene?
The canonical SMILES for 3-iodo-5,7-dimethyl-1-benzothiophene is Cc1cc(C)c2scc(I)c2c1.
What is the InChIKey of 3-iodo-5,7-dimethyl-1-benzothiophene?
The InChIKey is WIZKVYLNLFCDJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IS/c1-6-3-7(2)10-8(4-6)9(11)5-12-10/h3-5H,1-2H3.
What are the key properties of 3-iodo-5,7-dimethyl-1-benzothiophene?
3-iodo-5,7-dimethyl-1-benzothiophene has a molecular weight of 288.15 g/mol, XLogP of 4.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-5,7-dimethyl-1-benzothiophene is sourced from PubChem (CID 131053740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).