C12H13IS — CID 131076013
5,7-diethyl-3-iodo-1-benzothiophene (PubChem CID 131076013) has the molecular formula C12H13IS and a molecular weight of 316.21 g/mol. Its IUPAC name is 5,7-diethyl-3-iodo-1-benzothiophene.
| Compound Name | 5,7-diethyl-3-iodo-1-benzothiophene |
|---|---|
| PubChem CID | 131076013 |
| Molecular Formula | C12H13IS |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 5,7-diethyl-3-iodo-1-benzothiophene |
| SMILES | CCc1cc(CC)c2scc(I)c2c1 |
| InChI | InChI=1S/C12H13IS/c1-3-8-5-9(4-2)12-10(6-8)11(13)7-14-12/h5-7H,3-4H2,1-2H3 |
| InChIKey | MWQKZWZLVMOHLS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|