C9H6I2OS — CID 130866328
3,7-diiodo-5-methoxy-1-benzothiophene (PubChem CID 130866328) has the molecular formula C9H6I2OS and a molecular weight of 416.02 g/mol. Its IUPAC name is 3,7-diiodo-5-methoxy-1-benzothiophene.
| Compound Name | 3,7-diiodo-5-methoxy-1-benzothiophene |
|---|---|
| PubChem CID | 130866328 |
| Molecular Formula | C9H6I2OS |
| Molecular Weight | 416.02 g/mol |
| Exact Mass | 415.82 |
| IUPAC Name | 3,7-diiodo-5-methoxy-1-benzothiophene |
| SMILES | COc1cc(I)c2scc(I)c2c1 |
| InChI | InChI=1S/C9H6I2OS/c1-12-5-2-6-8(11)4-13-9(6)7(10)3-5/h2-4H,1H3 |
| InChIKey | LLLTXPULEWYENZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.02 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|