C18H14O2S — CID 89375674
6,9-dimethoxyphenanthro[9,10-b]thiophene (PubChem CID 89375674) has the molecular formula C18H14O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 6,9-dimethoxyphenanthro[9,10-b]thiophene.
| Compound Name | 6,9-dimethoxyphenanthro[9,10-b]thiophene |
|---|---|
| PubChem CID | 89375674 |
| Molecular Formula | C18H14O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 6,9-dimethoxyphenanthro[9,10-b]thiophene |
| SMILES | COc1ccc2c(c1)c1cc(OC)ccc1c1sccc21 |
| InChI | InChI=1S/C18H14O2S/c1-19-11-3-5-13-15-7-8-21-18(15)14-6-4-12(20-2)10-17(14)16(13)9-11/h3-10H,1-2H3 |
| InChIKey | CKWAOPOFBKAVJY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|