C13H8OS3 — CID 58400818
4-methoxy-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene (PubChem CID 58400818) has the molecular formula C13H8OS3 and a molecular weight of 276.41 g/mol. Its IUPAC name is 4-methoxy-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene.
| Compound Name | 4-methoxy-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
|---|---|
| PubChem CID | 58400818 |
| Molecular Formula | C13H8OS3 |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 4-methoxy-3,8,13-trithiatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
| SMILES | COc1cc2c3sccc3c3sccc3c2s1 |
| InChI | InChI=1S/C13H8OS3/c1-14-10-6-9-12-7(2-4-16-12)11-8(3-5-15-11)13(9)17-10/h2-6H,1H3 |
| InChIKey | NRSCQAUXHXZKAM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |