C12H9NO2S — CID 58024740
8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one (PubChem CID 58024740) has the molecular formula C12H9NO2S and a molecular weight of 231.28 g/mol. Its IUPAC name is 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one.
| Compound Name | 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 58024740 |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one |
| SMILES | COc1ccc2c(=O)[nH]c3sccc3c2c1 |
| InChI | InChI=1S/C12H9NO2S/c1-15-7-2-3-8-10(6-7)9-4-5-16-12(9)13-11(8)14/h2-6H,1H3,(H,13,14) |
| InChIKey | HTTRFYNWHOXUPE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |