About 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one
8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one (PubChem CID 58024740) has the molecular formula C12H9NO2S
and a molecular weight of 231.28 g/mol. Its IUPAC name is 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one.
Molecular Properties
| Compound Name | 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one |
| PubChem CID | 58024740 |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one |
| SMILES | COc1ccc2c(=O)[nH]c3sccc3c2c1 |
| InChI | InChI=1S/C12H9NO2S/c1-15-7-2-3-8-10(6-7)9-4-5-16-12(9)13-11(8)14/h2-6H,1H3,(H,13,14) |
| InChIKey | HTTRFYNWHOXUPE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one?
The IUPAC name of 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one (CID 58024740) is 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one.
What is the SMILES notation for 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one?
The canonical SMILES for 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one is COc1ccc2c(=O)[nH]c3sccc3c2c1.
What is the InChIKey of 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one?
The InChIKey is HTTRFYNWHOXUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2S/c1-15-7-2-3-8-10(6-7)9-4-5-16-12(9)13-11(8)14/h2-6H,1H3,(H,13,14).
What are the key properties of 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one?
8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one has a molecular weight of 231.28 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-4H-thieno[2,3-c]isoquinolin-5-one is sourced from PubChem (CID 58024740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).