C11H7NO2S — CID 161231673
8-hydroxy-4H-thieno[2,3-c]isoquinolin-5-one (PubChem CID 161231673) has the molecular formula C11H7NO2S and a molecular weight of 217.25 g/mol. Its IUPAC name is 8-hydroxy-4H-thieno[2,3-c]isoquinolin-5-one.
| Compound Name | 8-hydroxy-4H-thieno[2,3-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 161231673 |
| Molecular Formula | C11H7NO2S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 8-hydroxy-4H-thieno[2,3-c]isoquinolin-5-one |
| SMILES | O=c1[nH]c2sccc2c2cc(O)ccc12 |
| InChI | InChI=1S/C11H7NO2S/c13-6-1-2-7-9(5-6)8-3-4-15-11(8)12-10(7)14/h1-5,13H,(H,12,14) |
| InChIKey | UYVFDEFXTXVVAF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |