C19H12FNO3S — CID 67297381
5-fluoro-3-(4-hydroxyphenyl)-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione (PubChem CID 67297381) has the molecular formula C19H12FNO3S and a molecular weight of 353.37 g/mol. Its IUPAC name is 5-fluoro-3-(4-hydroxyphenyl)-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione.
| Compound Name | 5-fluoro-3-(4-hydroxyphenyl)-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione |
|---|---|
| PubChem CID | 67297381 |
| Molecular Formula | C19H12FNO3S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 5-fluoro-3-(4-hydroxyphenyl)-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione |
| SMILES | O=C1Nc2scc(-c3ccc(O)cc3)c2C(=O)C1(F)c1ccccc1 |
| InChI | InChI=1S/C19H12FNO3S/c20-19(12-4-2-1-3-5-12)16(23)15-14(10-25-17(15)21-18(19)24)11-6-8-13(22)9-7-11/h1-10,22H,(H,21,24) |
| InChIKey | BIXMBERAWZDIBT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|