C17H11F3N2O3S — CID 170454070
6-hydroxy-2-[[4-(trifluoromethyl)benzoyl]amino]-1-benzothiophene-3-carboxamide (PubChem CID 170454070) has the molecular formula C17H11F3N2O3S and a molecular weight of 380.35 g/mol. Its IUPAC name is 6-hydroxy-2-[[4-(trifluoromethyl)benzoyl]amino]-1-benzothiophene-3-carboxamide.
| Compound Name | 6-hydroxy-2-[[4-(trifluoromethyl)benzoyl]amino]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 170454070 |
| Molecular Formula | C17H11F3N2O3S |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 6-hydroxy-2-[[4-(trifluoromethyl)benzoyl]amino]-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)c2ccc(C(F)(F)F)cc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C17H11F3N2O3S/c18-17(19,20)9-3-1-8(2-4-9)15(25)22-16-13(14(21)24)11-6-5-10(23)7-12(11)26-16/h1-7,23H,(H2,21,24)(H,22,25) |
| InChIKey | KHUWLBSJTSDFCQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |