C20H20FN3O3S — CID 167713855
7-[(dimethylamino)methyl]-2-[(4-fluorobenzoyl)amino]-6-hydroxy-N-methyl-1-benzothiophene-3-carboxamide (PubChem CID 167713855) has the molecular formula C20H20FN3O3S and a molecular weight of 401.46 g/mol. Its IUPAC name is 7-[(dimethylamino)methyl]-2-[(4-fluorobenzoyl)amino]-6-hydroxy-N-methyl-1-benzothiophene-3-carboxamide.
| Compound Name | 7-[(dimethylamino)methyl]-2-[(4-fluorobenzoyl)amino]-6-hydroxy-N-methyl-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 167713855 |
| Molecular Formula | C20H20FN3O3S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 7-[(dimethylamino)methyl]-2-[(4-fluorobenzoyl)amino]-6-hydroxy-N-methyl-1-benzothiophene-3-carboxamide |
| SMILES | CNC(=O)c1c(NC(=O)c2ccc(F)cc2)sc2c(CN(C)C)c(O)ccc12 |
| InChI | InChI=1S/C20H20FN3O3S/c1-22-19(27)16-13-8-9-15(25)14(10-24(2)3)17(13)28-20(16)23-18(26)11-4-6-12(21)7-5-11/h4-9,25H,10H2,1-3H3,(H,22,27)(H,23,26) |
| InChIKey | DHOIAOLEBYXXNI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|