C20H17NO4S — CID 122181143
2-[3-[4-(4-hydroxyphenyl)phenyl]propanoylamino]thiophene-3-carboxylic acid (PubChem CID 122181143) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[3-[4-(4-hydroxyphenyl)phenyl]propanoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[3-[4-(4-hydroxyphenyl)phenyl]propanoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 122181143 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[3-[4-(4-hydroxyphenyl)phenyl]propanoylamino]thiophene-3-carboxylic acid |
| SMILES | O=C(CCc1ccc(-c2ccc(O)cc2)cc1)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C20H17NO4S/c22-16-8-6-15(7-9-16)14-4-1-13(2-5-14)3-10-18(23)21-19-17(20(24)25)11-12-26-19/h1-2,4-9,11-12,22H,3,10H2,(H,21,23)(H,24,25) |
| InChIKey | CSRAIWQUACQRNV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |