C8H13BrN2S — CID 131106333
5-bromo-N,4-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide (PubChem CID 131106333) has the molecular formula C8H13BrN2S and a molecular weight of 249.18 g/mol. Its IUPAC name is 5-bromo-N,4-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide.
| Compound Name | 5-bromo-N,4-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
|---|---|
| PubChem CID | 131106333 |
| Molecular Formula | C8H13BrN2S |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 5-bromo-N,4-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
| SMILES | CNC(=S)N1CCC(C)=C(Br)C1 |
| InChI | InChI=1S/C8H13BrN2S/c1-6-3-4-11(5-7(6)9)8(12)10-2/h3-5H2,1-2H3,(H,10,12) |
| InChIKey | IWUUVJRAEHKFHV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|