C10H18N2S — CID 131155835
N-ethyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide (PubChem CID 131155835) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is N-ethyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide.
| Compound Name | N-ethyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
|---|---|
| PubChem CID | 131155835 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-ethyl-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
| SMILES | CCNC(=S)N1CCC(C)=C(C)C1 |
| InChI | InChI=1S/C10H18N2S/c1-4-11-10(13)12-6-5-8(2)9(3)7-12/h4-7H2,1-3H3,(H,11,13) |
| InChIKey | JUJZVOYSZLWFGK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|