C4Cl3F3N2O — CID 131107504
5-(trichloromethyl)-3-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 131107504) has the molecular formula C4Cl3F3N2O and a molecular weight of 255.41 g/mol. Its IUPAC name is 5-(trichloromethyl)-3-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(trichloromethyl)-3-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 131107504 |
| Molecular Formula | C4Cl3F3N2O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 253.90 |
| IUPAC Name | 5-(trichloromethyl)-3-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | FC(F)(F)c1noc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C4Cl3F3N2O/c5-3(6,7)2-11-1(12-13-2)4(8,9)10 |
| InChIKey | JLTDSWHSTIHCHC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|