C10H4Cl4F2N2O — CID 118396384
3-[(4-chlorophenyl)-difluoromethyl]-5-(trichloromethyl)-1,2,4-oxadiazole (PubChem CID 118396384) has the molecular formula C10H4Cl4F2N2O and a molecular weight of 347.96 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)-difluoromethyl]-5-(trichloromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[(4-chlorophenyl)-difluoromethyl]-5-(trichloromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 118396384 |
| Molecular Formula | C10H4Cl4F2N2O |
| Molecular Weight | 347.96 g/mol |
| Exact Mass | 345.90 |
| IUPAC Name | 3-[(4-chlorophenyl)-difluoromethyl]-5-(trichloromethyl)-1,2,4-oxadiazole |
| SMILES | FC(F)(c1ccc(Cl)cc1)c1noc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C10H4Cl4F2N2O/c11-6-3-1-5(2-4-6)9(15,16)7-17-8(19-18-7)10(12,13)14/h1-4H |
| InChIKey | BOMLJLVQSZZRMP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.96 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|