C8H11NOS — CID 131107624
1-(3-methyl-1,2-thiazol-5-yl)but-3-en-1-ol (PubChem CID 131107624) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 1-(3-methyl-1,2-thiazol-5-yl)but-3-en-1-ol.
| Compound Name | 1-(3-methyl-1,2-thiazol-5-yl)but-3-en-1-ol |
|---|---|
| PubChem CID | 131107624 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 1-(3-methyl-1,2-thiazol-5-yl)but-3-en-1-ol |
| SMILES | C=CCC(O)c1cc(C)ns1 |
| InChI | InChI=1S/C8H11NOS/c1-3-4-7(10)8-5-6(2)9-11-8/h3,5,7,10H,1,4H2,2H3 |
| InChIKey | CGQKYOJUMSFHLU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|