C14H20O2 — CID 13112019
(1R,2S,7R,8R)-1,4-dimethoxytricyclo[6.2.2.02,7]dodeca-3,9-diene (PubChem CID 13112019) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (1R,2S,7R,8R)-1,4-dimethoxytricyclo[6.2.2.02,7]dodeca-3,9-diene.
| Compound Name | (1R,2S,7R,8R)-1,4-dimethoxytricyclo[6.2.2.02,7]dodeca-3,9-diene |
|---|---|
| PubChem CID | 13112019 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (1R,2S,7R,8R)-1,4-dimethoxytricyclo[6.2.2.02,7]dodeca-3,9-diene |
| SMILES | COC1=C[C@@H]2[C@H](CC1)[C@H]1C=C[C@]2(OC)CC1 |
| InChI | InChI=1S/C14H20O2/c1-15-11-3-4-12-10-5-7-14(16-2,8-6-10)13(12)9-11/h5,7,9-10,12-13H,3-4,6,8H2,1-2H3/t10-,12+,13+,14-/m0/s1 |
| InChIKey | SJHKORKWMZCXHD-ASEORRQLSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|