C19H30O — CID 134935064
(1R,4R)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methoxybicyclo[2.2.2]oct-2-ene (PubChem CID 134935064) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (1R,4R)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methoxybicyclo[2.2.2]oct-2-ene.
| Compound Name | (1R,4R)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methoxybicyclo[2.2.2]oct-2-ene |
|---|---|
| PubChem CID | 134935064 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (1R,4R)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-methoxybicyclo[2.2.2]oct-2-ene |
| SMILES | CO[C@]12C=C[C@H](CC1)CC2C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C19H30O/c1-15(2)6-5-7-16(3)8-9-18-14-17-10-12-19(18,20-4)13-11-17/h6,8,10,12,17-18H,5,7,9,11,13-14H2,1-4H3/b16-8+/t17-,18?,19-/m1/s1 |
| InChIKey | VPHDKQARPOFRSH-ZNXXUTGDSA-N |
| XLogP | 5.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|