C19H32O4 — CID 174919120
bicyclo[2.2.1]hept-2-ene;3,7-dimethyl-1,1-bis(methylperoxy)octa-2,6-diene (PubChem CID 174919120) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;3,7-dimethyl-1,1-bis(methylperoxy)octa-2,6-diene.
| Compound Name | bicyclo[2.2.1]hept-2-ene;3,7-dimethyl-1,1-bis(methylperoxy)octa-2,6-diene |
|---|---|
| PubChem CID | 174919120 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;3,7-dimethyl-1,1-bis(methylperoxy)octa-2,6-diene |
| SMILES | C1=CC2CCC1C2.COOC(C=C(C)CCC=C(C)C)OOC |
| InChI | InChI=1S/C12H22O4.C7H10/c1-10(2)7-6-8-11(3)9-12(15-13-4)16-14-5;1-2-7-4-3-6(1)5-7/h7,9,12H,6,8H2,1-5H3;1-2,6-7H,3-5H2 |
| InChIKey | OJZHYYWIZJEXFJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|