C10H3BrN2S — CID 131123178
5-bromo-1-benzothiophene-3,6-dicarbonitrile (PubChem CID 131123178) has the molecular formula C10H3BrN2S and a molecular weight of 263.12 g/mol. Its IUPAC name is 5-bromo-1-benzothiophene-3,6-dicarbonitrile.
| Compound Name | 5-bromo-1-benzothiophene-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 131123178 |
| Molecular Formula | C10H3BrN2S |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 261.92 |
| IUPAC Name | 5-bromo-1-benzothiophene-3,6-dicarbonitrile |
| SMILES | N#Cc1cc2scc(C#N)c2cc1Br |
| InChI | InChI=1S/C10H3BrN2S/c11-9-2-8-7(4-13)5-14-10(8)1-6(9)3-12/h1-2,5H |
| InChIKey | BNWHOMDZKIIVPV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |