C8H12IN3O — CID 131123319
3-[(5-iodopyrimidin-4-yl)amino]butan-2-ol (PubChem CID 131123319) has the molecular formula C8H12IN3O and a molecular weight of 293.11 g/mol. Its IUPAC name is 3-[(5-iodopyrimidin-4-yl)amino]butan-2-ol.
| Compound Name | 3-[(5-iodopyrimidin-4-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 131123319 |
| Molecular Formula | C8H12IN3O |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 3-[(5-iodopyrimidin-4-yl)amino]butan-2-ol |
| SMILES | CC(O)C(C)Nc1ncncc1I |
| InChI | InChI=1S/C8H12IN3O/c1-5(6(2)13)12-8-7(9)3-10-4-11-8/h3-6,13H,1-2H3,(H,10,11,12) |
| InChIKey | IJXTYHWURWWHBB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|