C10H17IN4 — CID 66319039
2-N-(5-iodopyrimidin-4-yl)-4-methylpentane-1,2-diamine (PubChem CID 66319039) has the molecular formula C10H17IN4 and a molecular weight of 320.18 g/mol. Its IUPAC name is 2-N-(5-iodopyrimidin-4-yl)-4-methylpentane-1,2-diamine.
| Compound Name | 2-N-(5-iodopyrimidin-4-yl)-4-methylpentane-1,2-diamine |
|---|---|
| PubChem CID | 66319039 |
| Molecular Formula | C10H17IN4 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-N-(5-iodopyrimidin-4-yl)-4-methylpentane-1,2-diamine |
| SMILES | CC(C)CC(CN)Nc1ncncc1I |
| InChI | InChI=1S/C10H17IN4/c1-7(2)3-8(4-12)15-10-9(11)5-13-6-14-10/h5-8H,3-4,12H2,1-2H3,(H,13,14,15) |
| InChIKey | MBDONZXXYRJSHF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|