C10H16IN3O — CID 66340998
2-[(5-iodopyrimidin-4-yl)amino]-4-methylpentan-1-ol (PubChem CID 66340998) has the molecular formula C10H16IN3O and a molecular weight of 321.16 g/mol. Its IUPAC name is 2-[(5-iodopyrimidin-4-yl)amino]-4-methylpentan-1-ol.
| Compound Name | 2-[(5-iodopyrimidin-4-yl)amino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 66340998 |
| Molecular Formula | C10H16IN3O |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2-[(5-iodopyrimidin-4-yl)amino]-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)Nc1ncncc1I |
| InChI | InChI=1S/C10H16IN3O/c1-7(2)3-8(5-15)14-10-9(11)4-12-6-13-10/h4,6-8,15H,3,5H2,1-2H3,(H,12,13,14) |
| InChIKey | AIWLPAJGDDZZJZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|