C25H20F3N3O5S — CID 13114944
ethyl 4,6-diphenyl-1-pyrimidin-2-ylpyridin-1-ium-2-carboxylate;trifluoromethanesulfonate (PubChem CID 13114944) has the molecular formula C25H20F3N3O5S and a molecular weight of 531.51 g/mol. Its IUPAC name is ethyl 4,6-diphenyl-1-pyrimidin-2-ylpyridin-1-ium-2-carboxylate;trifluoromethanesulfonate.
| Compound Name | ethyl 4,6-diphenyl-1-pyrimidin-2-ylpyridin-1-ium-2-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 13114944 |
| Molecular Formula | C25H20F3N3O5S |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | ethyl 4,6-diphenyl-1-pyrimidin-2-ylpyridin-1-ium-2-carboxylate;trifluoromethanesulfonate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)cc(-c2ccccc2)[n+]1-c1ncccn1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C24H20N3O2.CHF3O3S/c1-2-29-23(28)22-17-20(18-10-5-3-6-11-18)16-21(19-12-7-4-8-13-19)27(22)24-25-14-9-15-26-24;2-1(3,4)8(5,6)7/h3-17H,2H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | WEMHYIIAINQPFS-UHFFFAOYSA-M |
| XLogP | 4.32 |
| TPSA | 113.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|