C8H14O3 — CID 131155270
(1R,6S)-6-(hydroxymethyl)-4-methylcyclohex-4-ene-1,3-diol (PubChem CID 131155270) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (1R,6S)-6-(hydroxymethyl)-4-methylcyclohex-4-ene-1,3-diol.
| Compound Name | (1R,6S)-6-(hydroxymethyl)-4-methylcyclohex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 131155270 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (1R,6S)-6-(hydroxymethyl)-4-methylcyclohex-4-ene-1,3-diol |
| SMILES | CC1=C[C@@H](CO)[C@H](O)CC1O |
| InChI | InChI=1S/C8H14O3/c1-5-2-6(4-9)8(11)3-7(5)10/h2,6-11H,3-4H2,1H3/t6-,7?,8+/m0/s1 |
| InChIKey | YRPZSNVGTDWSON-YPVSKDHRSA-N |
| XLogP | -0.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|