C7H13N3O2 — CID 131165993
1-methyl-4-(oxetan-3-ylamino)pyrazolidin-3-one (PubChem CID 131165993) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-methyl-4-(oxetan-3-ylamino)pyrazolidin-3-one.
| Compound Name | 1-methyl-4-(oxetan-3-ylamino)pyrazolidin-3-one |
|---|---|
| PubChem CID | 131165993 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1-methyl-4-(oxetan-3-ylamino)pyrazolidin-3-one |
| SMILES | CN1CC(NC2COC2)C(=O)N1 |
| InChI | InChI=1S/C7H13N3O2/c1-10-2-6(7(11)9-10)8-5-3-12-4-5/h5-6,8H,2-4H2,1H3,(H,9,11) |
| InChIKey | QYVBFDNKHGPIQN-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |