C9H18N4O — CID 130892992
1-methyl-4-[(1-methylpyrrolidin-3-yl)amino]pyrazolidin-3-one (PubChem CID 130892992) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-methyl-4-[(1-methylpyrrolidin-3-yl)amino]pyrazolidin-3-one.
| Compound Name | 1-methyl-4-[(1-methylpyrrolidin-3-yl)amino]pyrazolidin-3-one |
|---|---|
| PubChem CID | 130892992 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 1-methyl-4-[(1-methylpyrrolidin-3-yl)amino]pyrazolidin-3-one |
| SMILES | CN1CCC(NC2CN(C)NC2=O)C1 |
| InChI | InChI=1S/C9H18N4O/c1-12-4-3-7(5-12)10-8-6-13(2)11-9(8)14/h7-8,10H,3-6H2,1-2H3,(H,11,14) |
| InChIKey | GNAZKVMWZGFQEH-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |