C7H14N4O2 — CID 131026035
2-(methylamino)-N-(1-methyl-3-oxopyrazolidin-4-yl)acetamide (PubChem CID 131026035) has the molecular formula C7H14N4O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-(methylamino)-N-(1-methyl-3-oxopyrazolidin-4-yl)acetamide.
| Compound Name | 2-(methylamino)-N-(1-methyl-3-oxopyrazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 131026035 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 2-(methylamino)-N-(1-methyl-3-oxopyrazolidin-4-yl)acetamide |
| SMILES | CNCC(=O)NC1CN(C)NC1=O |
| InChI | InChI=1S/C7H14N4O2/c1-8-3-6(12)9-5-4-11(2)10-7(5)13/h5,8H,3-4H2,1-2H3,(H,9,12)(H,10,13) |
| InChIKey | AIRFEHQZGLXPRM-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |