C9H17N3O2 — CID 130979763
2,2-dimethyl-N-(1-methyl-3-oxopyrazolidin-4-yl)propanamide (PubChem CID 130979763) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2,2-dimethyl-N-(1-methyl-3-oxopyrazolidin-4-yl)propanamide.
| Compound Name | 2,2-dimethyl-N-(1-methyl-3-oxopyrazolidin-4-yl)propanamide |
|---|---|
| PubChem CID | 130979763 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2,2-dimethyl-N-(1-methyl-3-oxopyrazolidin-4-yl)propanamide |
| SMILES | CN1CC(NC(=O)C(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C9H17N3O2/c1-9(2,3)8(14)10-6-5-12(4)11-7(6)13/h6H,5H2,1-4H3,(H,10,14)(H,11,13) |
| InChIKey | NKDLINKHRFPTLS-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |