C25H23NO6 — CID 13117094
[4-[(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)oxy]phenyl]-phenylmethanone;oxalic acid (PubChem CID 13117094) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is [4-[(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)oxy]phenyl]-phenylmethanone;oxalic acid.
| Compound Name | [4-[(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)oxy]phenyl]-phenylmethanone;oxalic acid |
|---|---|
| PubChem CID | 13117094 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [4-[(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)oxy]phenyl]-phenylmethanone;oxalic acid |
| SMILES | CN1Cc2ccccc2C(Oc2ccc(C(=O)c3ccccc3)cc2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H21NO2.C2H2O4/c1-24-15-19-9-5-6-10-21(19)22(16-24)26-20-13-11-18(12-14-20)23(25)17-7-3-2-4-8-17;3-1(4)2(5)6/h2-14,22H,15-16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JBXAINNBSBGEII-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|