C48H40N2O8 — CID 57150342
bis[4-(4-benzoylphenoxy)-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl] oxalate (PubChem CID 57150342) has the molecular formula C48H40N2O8 and a molecular weight of 772.85 g/mol. Its IUPAC name is bis[4-(4-benzoylphenoxy)-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl] oxalate.
| Compound Name | bis[4-(4-benzoylphenoxy)-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl] oxalate |
|---|---|
| PubChem CID | 57150342 |
| Molecular Formula | C48H40N2O8 |
| Molecular Weight | 772.85 g/mol |
| Exact Mass | 772.28 |
| IUPAC Name | bis[4-(4-benzoylphenoxy)-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl] oxalate |
| SMILES | CN1CC(Oc2ccc(C(=O)c3ccccc3)cc2)c2ccccc2C1OC(=O)C(=O)OC1c2ccccc2C(Oc2ccc(C(=O)c3ccccc3)cc2)CN1C |
| InChI | InChI=1S/C48H40N2O8/c1-49-29-41(55-35-25-21-33(22-26-35)43(51)31-13-5-3-6-14-31)37-17-9-11-19-39(37)45(49)57-47(53)48(54)58-46-40-20-12-10-18-38(40)42(30-50(46)2)56-36-27-23-34(24-28-36)44(52)32-15-7-4-8-16-32/h3-28,41-42,45-46H,29-30H2,1-2H3 |
| InChIKey | VTRBMUVBPZDKDE-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.85 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|