C11H20N2 — CID 131177145
3,4,5-trimethyl-1-(3-methylbutan-2-yl)pyrazole (PubChem CID 131177145) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 3,4,5-trimethyl-1-(3-methylbutan-2-yl)pyrazole.
| Compound Name | 3,4,5-trimethyl-1-(3-methylbutan-2-yl)pyrazole |
|---|---|
| PubChem CID | 131177145 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 3,4,5-trimethyl-1-(3-methylbutan-2-yl)pyrazole |
| SMILES | Cc1nn(C(C)C(C)C)c(C)c1C |
| InChI | InChI=1S/C11H20N2/c1-7(2)10(5)13-11(6)8(3)9(4)12-13/h7,10H,1-6H3 |
| InChIKey | GPJDWONKPORALK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |