C9H16N4O — CID 94133466
(2R)-2-(3,4,5-trimethylpyrazol-1-yl)propanehydrazide (PubChem CID 94133466) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is (2R)-2-(3,4,5-trimethylpyrazol-1-yl)propanehydrazide.
| Compound Name | (2R)-2-(3,4,5-trimethylpyrazol-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 94133466 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (2R)-2-(3,4,5-trimethylpyrazol-1-yl)propanehydrazide |
| SMILES | Cc1nn([C@H](C)C(=O)NN)c(C)c1C |
| InChI | InChI=1S/C9H16N4O/c1-5-6(2)12-13(7(5)3)8(4)9(14)11-10/h8H,10H2,1-4H3,(H,11,14)/t8-/m1/s1 |
| InChIKey | DMYVGBHQQYKTFD-MRVPVSSYSA-N |
| XLogP | 0.36 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|