About N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine
N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine (PubChem CID 62440976) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine.
Analyze N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine?
The IUPAC name of N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine (CID 62440976) is N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine.
What is the SMILES notation for N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine?
The canonical SMILES for N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine is CCNCC(C)n1nc(C)c(C)c1C.
What is the InChIKey of N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine?
The InChIKey is TWIBDQJJDGVJAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-6-12-7-8(2)14-11(5)9(3)10(4)13-14/h8,12H,6-7H2,1-5H3.
What are the key properties of N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine?
N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine has a molecular weight of 195.31 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(3,4,5-trimethylpyrazol-1-yl)propan-1-amine is sourced from PubChem (CID 62440976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).