C8H8O4 — CID 131186543
(1R,5R)-bicyclo[3.1.0]hex-2-ene-1,5-dicarboxylic acid (PubChem CID 131186543) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is (1R,5R)-bicyclo[3.1.0]hex-2-ene-1,5-dicarboxylic acid.
| Compound Name | (1R,5R)-bicyclo[3.1.0]hex-2-ene-1,5-dicarboxylic acid |
|---|---|
| PubChem CID | 131186543 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (1R,5R)-bicyclo[3.1.0]hex-2-ene-1,5-dicarboxylic acid |
| SMILES | O=C(O)[C@@]12CC=C[C@]1(C(=O)O)C2 |
| InChI | InChI=1S/C8H8O4/c9-5(10)7-2-1-3-8(7,4-7)6(11)12/h1-2H,3-4H2,(H,9,10)(H,11,12)/t7-,8+/m1/s1 |
| InChIKey | KSTODAOVDHCBRT-SFYZADRCSA-N |
| XLogP | 0.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|