C9H12O4S — CID 150252255
3-methyl-1-sulfanylcyclohex-4-ene-1,3-dicarboxylic acid (PubChem CID 150252255) has the molecular formula C9H12O4S and a molecular weight of 216.26 g/mol. Its IUPAC name is 3-methyl-1-sulfanylcyclohex-4-ene-1,3-dicarboxylic acid.
| Compound Name | 3-methyl-1-sulfanylcyclohex-4-ene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150252255 |
| Molecular Formula | C9H12O4S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 3-methyl-1-sulfanylcyclohex-4-ene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CCC(S)(C(=O)O)C1 |
| InChI | InChI=1S/C9H12O4S/c1-8(6(10)11)3-2-4-9(14,5-8)7(12)13/h2-3,14H,4-5H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | FZURGPMXAIVASF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|