C15H23NO4S — CID 174881668
1-(2,2-dimethylthiomorpholin-3-yl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid (PubChem CID 174881668) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-(2,2-dimethylthiomorpholin-3-yl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid.
| Compound Name | 1-(2,2-dimethylthiomorpholin-3-yl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174881668 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-(2,2-dimethylthiomorpholin-3-yl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CCC(C(=O)O)(C2NCCSC2(C)C)C1 |
| InChI | InChI=1S/C15H23NO4S/c1-13(2)10(16-7-8-21-13)15(12(19)20)6-4-5-14(3,9-15)11(17)18/h4-5,10,16H,6-9H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | DIOXXFGWTFJBBS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|