C15H15BrO4 — CID 150841991
1-(2-bromophenyl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid (PubChem CID 150841991) has the molecular formula C15H15BrO4 and a molecular weight of 339.19 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid.
| Compound Name | 1-(2-bromophenyl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150841991 |
| Molecular Formula | C15H15BrO4 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 1-(2-bromophenyl)-3-methylcyclohex-4-ene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CCC(C(=O)O)(c2ccccc2Br)C1 |
| InChI | InChI=1S/C15H15BrO4/c1-14(12(17)18)7-4-8-15(9-14,13(19)20)10-5-2-3-6-11(10)16/h2-7H,8-9H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | KOEKFMMUWKSHCC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|